C23H26FN3O — CID 13490823
N-(1-benzylpiperidin-4-yl)-5-fluoro-1,2-dimethylindole-3-carboxamide (PubChem CID 13490823) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-5-fluoro-1,2-dimethylindole-3-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-5-fluoro-1,2-dimethylindole-3-carboxamide |
|---|---|
| PubChem CID | 13490823 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-5-fluoro-1,2-dimethylindole-3-carboxamide |
| SMILES | Cc1c(C(=O)NC2CCN(Cc3ccccc3)CC2)c2cc(F)ccc2n1C |
| InChI | InChI=1S/C23H26FN3O/c1-16-22(20-14-18(24)8-9-21(20)26(16)2)23(28)25-19-10-12-27(13-11-19)15-17-6-4-3-5-7-17/h3-9,14,19H,10-13,15H2,1-2H3,(H,25,28) |
| InChIKey | ZEELSQCMDWCFPK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |