C18H18BrFN2O — CID 18156414
N-(1-benzylpyrrolidin-3-yl)-2-bromo-5-fluorobenzamide (PubChem CID 18156414) has the molecular formula C18H18BrFN2O and a molecular weight of 377.26 g/mol. Its IUPAC name is N-(1-benzylpyrrolidin-3-yl)-2-bromo-5-fluorobenzamide.
| Compound Name | N-(1-benzylpyrrolidin-3-yl)-2-bromo-5-fluorobenzamide |
|---|---|
| PubChem CID | 18156414 |
| Molecular Formula | C18H18BrFN2O |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-2-bromo-5-fluorobenzamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)C1)c1cc(F)ccc1Br |
| InChI | InChI=1S/C18H18BrFN2O/c19-17-7-6-14(20)10-16(17)18(23)21-15-8-9-22(12-15)11-13-4-2-1-3-5-13/h1-7,10,15H,8-9,11-12H2,(H,21,23) |
| InChIKey | WNQVYFCKDKLZGA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |