C16H17BrN2O2 — CID 106853183
N-(1-benzylpyrrolidin-3-yl)-2-bromofuran-3-carboxamide (PubChem CID 106853183) has the molecular formula C16H17BrN2O2 and a molecular weight of 349.23 g/mol. Its IUPAC name is N-(1-benzylpyrrolidin-3-yl)-2-bromofuran-3-carboxamide.
| Compound Name | N-(1-benzylpyrrolidin-3-yl)-2-bromofuran-3-carboxamide |
|---|---|
| PubChem CID | 106853183 |
| Molecular Formula | C16H17BrN2O2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-2-bromofuran-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)C1)c1ccoc1Br |
| InChI | InChI=1S/C16H17BrN2O2/c17-15-14(7-9-21-15)16(20)18-13-6-8-19(11-13)10-12-4-2-1-3-5-12/h1-5,7,9,13H,6,8,10-11H2,(H,18,20) |
| InChIKey | JDSHNJJBUCWVQT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |