C20H20F4N2O — CID 141457665
N-(1-benzylpiperidin-3-yl)-4-fluoro-2-(trifluoromethyl)benzamide (PubChem CID 141457665) has the molecular formula C20H20F4N2O and a molecular weight of 380.39 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-4-fluoro-2-(trifluoromethyl)benzamide.
| Compound Name | N-(1-benzylpiperidin-3-yl)-4-fluoro-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 141457665 |
| Molecular Formula | C20H20F4N2O |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-4-fluoro-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCCN(Cc2ccccc2)C1)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C20H20F4N2O/c21-15-8-9-17(18(11-15)20(22,23)24)19(27)25-16-7-4-10-26(13-16)12-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2,(H,25,27) |
| InChIKey | GVTKNKCXLDTQQO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |