C19H22ClN3O — CID 113239287
2-amino-N-(1-benzylpiperidin-3-yl)-6-chlorobenzamide (PubChem CID 113239287) has the molecular formula C19H22ClN3O and a molecular weight of 343.86 g/mol. Its IUPAC name is 2-amino-N-(1-benzylpiperidin-3-yl)-6-chlorobenzamide.
| Compound Name | 2-amino-N-(1-benzylpiperidin-3-yl)-6-chlorobenzamide |
|---|---|
| PubChem CID | 113239287 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-amino-N-(1-benzylpiperidin-3-yl)-6-chlorobenzamide |
| SMILES | Nc1cccc(Cl)c1C(=O)NC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H22ClN3O/c20-16-9-4-10-17(21)18(16)19(24)22-15-8-5-11-23(13-15)12-14-6-2-1-3-7-14/h1-4,6-7,9-10,15H,5,8,11-13,21H2,(H,22,24) |
| InChIKey | JMZMSEZUHNEEBC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|