C19H20BrFN2O — CID 42958717
N-(1-benzylpiperidin-3-yl)-2-bromo-5-fluorobenzamide (PubChem CID 42958717) has the molecular formula C19H20BrFN2O and a molecular weight of 391.28 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-2-bromo-5-fluorobenzamide.
| Compound Name | N-(1-benzylpiperidin-3-yl)-2-bromo-5-fluorobenzamide |
|---|---|
| PubChem CID | 42958717 |
| Molecular Formula | C19H20BrFN2O |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-2-bromo-5-fluorobenzamide |
| SMILES | O=C(NC1CCCN(Cc2ccccc2)C1)c1cc(F)ccc1Br |
| InChI | InChI=1S/C19H20BrFN2O/c20-18-9-8-15(21)11-17(18)19(24)22-16-7-4-10-23(13-16)12-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2,(H,22,24) |
| InChIKey | GTMRBOBZIOAKDA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |