C20H21F3N2O3S — CID 55653777
N-(1-benzylpiperidin-3-yl)-4-(trifluoromethylsulfonyl)benzamide (PubChem CID 55653777) has the molecular formula C20H21F3N2O3S and a molecular weight of 426.46 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-4-(trifluoromethylsulfonyl)benzamide.
| Compound Name | N-(1-benzylpiperidin-3-yl)-4-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 55653777 |
| Molecular Formula | C20H21F3N2O3S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-4-(trifluoromethylsulfonyl)benzamide |
| SMILES | O=C(NC1CCCN(Cc2ccccc2)C1)c1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F3N2O3S/c21-20(22,23)29(27,28)18-10-8-16(9-11-18)19(26)24-17-7-4-12-25(14-17)13-15-5-2-1-3-6-15/h1-3,5-6,8-11,17H,4,7,12-14H2,(H,24,26) |
| InChIKey | XWURQMJCYBQCOZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |