C20H30FN3O — CID 87034548
1-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-(4-methylcyclohexyl)urea (PubChem CID 87034548) has the molecular formula C20H30FN3O and a molecular weight of 347.48 g/mol. Its IUPAC name is 1-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-(4-methylcyclohexyl)urea.
| Compound Name | 1-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-(4-methylcyclohexyl)urea |
|---|---|
| PubChem CID | 87034548 |
| Molecular Formula | C20H30FN3O |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 1-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-(4-methylcyclohexyl)urea |
| SMILES | CC1CCC(NC(=O)NC2CCN(Cc3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C20H30FN3O/c1-15-2-8-18(9-3-15)22-20(25)23-19-10-12-24(13-11-19)14-16-4-6-17(21)7-5-16/h4-7,15,18-19H,2-3,8-14H2,1H3,(H2,22,23,25) |
| InChIKey | SSIZGDNSLTXSQQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |