C19H30FN3O — CID 131930881
2-[ethyl(methyl)amino]-N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]butanamide (PubChem CID 131930881) has the molecular formula C19H30FN3O and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-[ethyl(methyl)amino]-N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]butanamide.
| Compound Name | 2-[ethyl(methyl)amino]-N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 131930881 |
| Molecular Formula | C19H30FN3O |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 2-[ethyl(methyl)amino]-N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]butanamide |
| SMILES | CCC(C(=O)NC1CCN(Cc2ccc(F)cc2)CC1)N(C)CC |
| InChI | InChI=1S/C19H30FN3O/c1-4-18(22(3)5-2)19(24)21-17-10-12-23(13-11-17)14-15-6-8-16(20)9-7-15/h6-9,17-18H,4-5,10-14H2,1-3H3,(H,21,24) |
| InChIKey | CKHSEZUSFYJDTA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |