C18H28FN3O2S — CID 51121961
N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-methylpiperidine-1-sulfonamide (PubChem CID 51121961) has the molecular formula C18H28FN3O2S and a molecular weight of 369.51 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-methylpiperidine-1-sulfonamide.
| Compound Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 51121961 |
| Molecular Formula | C18H28FN3O2S |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-methylpiperidine-1-sulfonamide |
| SMILES | CC1CCN(S(=O)(=O)NC2CCN(Cc3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C18H28FN3O2S/c1-15-6-12-22(13-7-15)25(23,24)20-18-8-10-21(11-9-18)14-16-2-4-17(19)5-3-16/h2-5,15,18,20H,6-14H2,1H3 |
| InChIKey | PUFLHBFPFXMGLH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |