C13H19NO3S — CID 94830309
4-[(4-methylpiperidin-1-yl)methyl]benzenesulfonic acid (PubChem CID 94830309) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-[(4-methylpiperidin-1-yl)methyl]benzenesulfonic acid.
| Compound Name | 4-[(4-methylpiperidin-1-yl)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 94830309 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-[(4-methylpiperidin-1-yl)methyl]benzenesulfonic acid |
| SMILES | CC1CCN(Cc2ccc(S(=O)(=O)O)cc2)CC1 |
| InChI | InChI=1S/C13H19NO3S/c1-11-6-8-14(9-7-11)10-12-2-4-13(5-3-12)18(15,16)17/h2-5,11H,6-10H2,1H3,(H,15,16,17) |
| InChIKey | IYXHITHQVFLQTQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|