C13H17Cl2N — CID 22197662
1-[(3,4-dichlorophenyl)methyl]-4-methylpiperidine (PubChem CID 22197662) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-4-methylpiperidine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 22197662 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-4-methylpiperidine |
| SMILES | CC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H17Cl2N/c1-10-4-6-16(7-5-10)9-11-2-3-12(14)13(15)8-11/h2-3,8,10H,4-7,9H2,1H3 |
| InChIKey | OCIHFTYZFXMFFQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |