C14H20Cl2N2 — CID 120775322
1-[(3,4-dichlorophenyl)methyl]-3,3-dimethylpiperidin-4-amine (PubChem CID 120775322) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3,3-dimethylpiperidin-4-amine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 120775322 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3,3-dimethylpiperidin-4-amine |
| SMILES | CC1(C)CN(Cc2ccc(Cl)c(Cl)c2)CCC1N |
| InChI | InChI=1S/C14H20Cl2N2/c1-14(2)9-18(6-5-13(14)17)8-10-3-4-11(15)12(16)7-10/h3-4,7,13H,5-6,8-9,17H2,1-2H3 |
| InChIKey | ZTSOLHYTOMYZBU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |