C11H13Cl2NS — CID 793280
4-[(3,4-dichlorophenyl)methyl]thiomorpholine (PubChem CID 793280) has the molecular formula C11H13Cl2NS and a molecular weight of 262.20 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]thiomorpholine.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]thiomorpholine |
|---|---|
| PubChem CID | 793280 |
| Molecular Formula | C11H13Cl2NS |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]thiomorpholine |
| SMILES | Clc1ccc(CN2CCSCC2)cc1Cl |
| InChI | InChI=1S/C11H13Cl2NS/c12-10-2-1-9(7-11(10)13)8-14-3-5-15-6-4-14/h1-2,7H,3-6,8H2 |
| InChIKey | FYPVUFBDBZDLEF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |