C12H14Cl2N2O — CID 12641830
N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-ylidene]hydroxylamine (PubChem CID 12641830) has the molecular formula C12H14Cl2N2O and a molecular weight of 273.16 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-ylidene]hydroxylamine.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 12641830 |
| Molecular Formula | C12H14Cl2N2O |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-ylidene]hydroxylamine |
| SMILES | ON=C1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C12H14Cl2N2O/c13-11-2-1-9(7-12(11)14)8-16-5-3-10(15-17)4-6-16/h1-2,7,17H,3-6,8H2 |
| InChIKey | BSTRPPSWQVZWGV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|