C17H18ClNO — CID 82980522
2-chloro-4-(1,2,4,5-tetrahydro-3-benzazepin-3-ylmethyl)phenol (PubChem CID 82980522) has the molecular formula C17H18ClNO and a molecular weight of 287.79 g/mol. Its IUPAC name is 2-chloro-4-(1,2,4,5-tetrahydro-3-benzazepin-3-ylmethyl)phenol.
| Compound Name | 2-chloro-4-(1,2,4,5-tetrahydro-3-benzazepin-3-ylmethyl)phenol |
|---|---|
| PubChem CID | 82980522 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-chloro-4-(1,2,4,5-tetrahydro-3-benzazepin-3-ylmethyl)phenol |
| SMILES | Oc1ccc(CN2CCc3ccccc3CC2)cc1Cl |
| InChI | InChI=1S/C17H18ClNO/c18-16-11-13(5-6-17(16)20)12-19-9-7-14-3-1-2-4-15(14)8-10-19/h1-6,11,20H,7-10,12H2 |
| InChIKey | BICIOJWYFQUOKC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |