C19H22ClNO3 — CID 56883892
2-chloro-4-[[4-(2-methoxyphenoxy)piperidin-1-yl]methyl]phenol (PubChem CID 56883892) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is 2-chloro-4-[[4-(2-methoxyphenoxy)piperidin-1-yl]methyl]phenol.
| Compound Name | 2-chloro-4-[[4-(2-methoxyphenoxy)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 56883892 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-chloro-4-[[4-(2-methoxyphenoxy)piperidin-1-yl]methyl]phenol |
| SMILES | COc1ccccc1OC1CCN(Cc2ccc(O)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H22ClNO3/c1-23-18-4-2-3-5-19(18)24-15-8-10-21(11-9-15)13-14-6-7-17(22)16(20)12-14/h2-7,12,15,22H,8-11,13H2,1H3 |
| InChIKey | HVANPPUCNNNXAO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |