C11H14ClNO — CID 78960004
2-chloro-4-(pyrrolidin-1-ylmethyl)phenol (PubChem CID 78960004) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 2-chloro-4-(pyrrolidin-1-ylmethyl)phenol.
| Compound Name | 2-chloro-4-(pyrrolidin-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 78960004 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-chloro-4-(pyrrolidin-1-ylmethyl)phenol |
| SMILES | Oc1ccc(CN2CCCC2)cc1Cl |
| InChI | InChI=1S/C11H14ClNO/c12-10-7-9(3-4-11(10)14)8-13-5-1-2-6-13/h3-4,7,14H,1-2,5-6,8H2 |
| InChIKey | DIQSLLUSEPJWDA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |