C14H21ClN2O — CID 113282904
2-chloro-4-[[4-methyl-4-(methylamino)piperidin-1-yl]methyl]phenol (PubChem CID 113282904) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 2-chloro-4-[[4-methyl-4-(methylamino)piperidin-1-yl]methyl]phenol.
| Compound Name | 2-chloro-4-[[4-methyl-4-(methylamino)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 113282904 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-chloro-4-[[4-methyl-4-(methylamino)piperidin-1-yl]methyl]phenol |
| SMILES | CNC1(C)CCN(Cc2ccc(O)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H21ClN2O/c1-14(16-2)5-7-17(8-6-14)10-11-3-4-13(18)12(15)9-11/h3-4,9,16,18H,5-8,10H2,1-2H3 |
| InChIKey | PFWUENHWOAOZSB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |