C13H15ClF3NO — CID 82981318
2-chloro-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]phenol (PubChem CID 82981318) has the molecular formula C13H15ClF3NO and a molecular weight of 293.72 g/mol. Its IUPAC name is 2-chloro-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]phenol.
| Compound Name | 2-chloro-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 82981318 |
| Molecular Formula | C13H15ClF3NO |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-chloro-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]phenol |
| SMILES | Oc1ccc(CN2CCC(C(F)(F)F)CC2)cc1Cl |
| InChI | InChI=1S/C13H15ClF3NO/c14-11-7-9(1-2-12(11)19)8-18-5-3-10(4-6-18)13(15,16)17/h1-2,7,10,19H,3-6,8H2 |
| InChIKey | NGXMDOSOVDEVTR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |