C18H29ClN2O — CID 142098999
2-chloro-4-[[4-[2-(diethylamino)ethyl]piperidin-1-yl]methyl]phenol (PubChem CID 142098999) has the molecular formula C18H29ClN2O and a molecular weight of 324.90 g/mol. Its IUPAC name is 2-chloro-4-[[4-[2-(diethylamino)ethyl]piperidin-1-yl]methyl]phenol.
| Compound Name | 2-chloro-4-[[4-[2-(diethylamino)ethyl]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 142098999 |
| Molecular Formula | C18H29ClN2O |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 2-chloro-4-[[4-[2-(diethylamino)ethyl]piperidin-1-yl]methyl]phenol |
| SMILES | CCN(CC)CCC1CCN(Cc2ccc(O)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H29ClN2O/c1-3-20(4-2)10-7-15-8-11-21(12-9-15)14-16-5-6-18(22)17(19)13-16/h5-6,13,15,22H,3-4,7-12,14H2,1-2H3 |
| InChIKey | YDGAJHLGEOWTCU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |