C22H40N2 — CID 142036971
4-(1-benzylpiperidin-4-yl)-N,N-diethylbutan-1-amine;ethane (PubChem CID 142036971) has the molecular formula C22H40N2 and a molecular weight of 332.58 g/mol. Its IUPAC name is 4-(1-benzylpiperidin-4-yl)-N,N-diethylbutan-1-amine;ethane.
| Compound Name | 4-(1-benzylpiperidin-4-yl)-N,N-diethylbutan-1-amine;ethane |
|---|---|
| PubChem CID | 142036971 |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | 4-(1-benzylpiperidin-4-yl)-N,N-diethylbutan-1-amine;ethane |
| SMILES | CC.CCN(CC)CCCCC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H34N2.C2H6/c1-3-21(4-2)15-9-8-10-19-13-16-22(17-14-19)18-20-11-6-5-7-12-20;1-2/h5-7,11-12,19H,3-4,8-10,13-18H2,1-2H3;1-2H3 |
| InChIKey | XAUVBMHYMTZMSY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|