C20H34N2 — CID 102272076
1-benzyl-N,N-dibutylpiperidin-4-amine (PubChem CID 102272076) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 1-benzyl-N,N-dibutylpiperidin-4-amine.
| Compound Name | 1-benzyl-N,N-dibutylpiperidin-4-amine |
|---|---|
| PubChem CID | 102272076 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 1-benzyl-N,N-dibutylpiperidin-4-amine |
| SMILES | CCCCN(CCCC)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H34N2/c1-3-5-14-22(15-6-4-2)20-12-16-21(17-13-20)18-19-10-8-7-9-11-19/h7-11,20H,3-6,12-18H2,1-2H3 |
| InChIKey | XQNIBDFCPGGKMN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |