C18H26N2 — CID 11097616
1-benzyl-N,N-dicyclopropylpiperidin-4-amine (PubChem CID 11097616) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-benzyl-N,N-dicyclopropylpiperidin-4-amine.
| Compound Name | 1-benzyl-N,N-dicyclopropylpiperidin-4-amine |
|---|---|
| PubChem CID | 11097616 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 1-benzyl-N,N-dicyclopropylpiperidin-4-amine |
| SMILES | c1ccc(CN2CCC(N(C3CC3)C3CC3)CC2)cc1 |
| InChI | InChI=1S/C18H26N2/c1-2-4-15(5-3-1)14-19-12-10-18(11-13-19)20(16-6-7-16)17-8-9-17/h1-5,16-18H,6-14H2 |
| InChIKey | VNBYYXWXZSIZBB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |