C25H33N3O2 — CID 141100652
3-(4-acetylphenyl)-1-(1-benzylpiperidin-4-yl)-1-butylurea (PubChem CID 141100652) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 3-(4-acetylphenyl)-1-(1-benzylpiperidin-4-yl)-1-butylurea.
| Compound Name | 3-(4-acetylphenyl)-1-(1-benzylpiperidin-4-yl)-1-butylurea |
|---|---|
| PubChem CID | 141100652 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 3-(4-acetylphenyl)-1-(1-benzylpiperidin-4-yl)-1-butylurea |
| SMILES | CCCCN(C(=O)Nc1ccc(C(C)=O)cc1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H33N3O2/c1-3-4-16-28(25(30)26-23-12-10-22(11-13-23)20(2)29)24-14-17-27(18-15-24)19-21-8-6-5-7-9-21/h5-13,24H,3-4,14-19H2,1-2H3,(H,26,30) |
| InChIKey | ZTAHPJMMJFWCCW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |