C27H28F3N3O — CID 126711712
1-benzyl-1-(1-benzylpiperidin-4-yl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 126711712) has the molecular formula C27H28F3N3O and a molecular weight of 467.54 g/mol. Its IUPAC name is 1-benzyl-1-(1-benzylpiperidin-4-yl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-benzyl-1-(1-benzylpiperidin-4-yl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 126711712 |
| Molecular Formula | C27H28F3N3O |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-benzyl-1-(1-benzylpiperidin-4-yl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N(Cc1ccccc1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H28F3N3O/c28-27(29,30)23-11-13-24(14-12-23)31-26(34)33(20-22-9-5-2-6-10-22)25-15-17-32(18-16-25)19-21-7-3-1-4-8-21/h1-14,25H,15-20H2,(H,31,34) |
| InChIKey | IWJOVQBPCVWHLK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |