C27H30ClN3OS — CID 42696418
1-(1-benzylpiperidin-4-yl)-1-[(4-chlorophenyl)methyl]-3-(4-methylsulfanylphenyl)urea (PubChem CID 42696418) has the molecular formula C27H30ClN3OS and a molecular weight of 480.08 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-1-[(4-chlorophenyl)methyl]-3-(4-methylsulfanylphenyl)urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-1-[(4-chlorophenyl)methyl]-3-(4-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 42696418 |
| Molecular Formula | C27H30ClN3OS |
| Molecular Weight | 480.08 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-1-[(4-chlorophenyl)methyl]-3-(4-methylsulfanylphenyl)urea |
| SMILES | CSc1ccc(NC(=O)N(Cc2ccc(Cl)cc2)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H30ClN3OS/c1-33-26-13-11-24(12-14-26)29-27(32)31(20-22-7-9-23(28)10-8-22)25-15-17-30(18-16-25)19-21-5-3-2-4-6-21/h2-14,25H,15-20H2,1H3,(H,29,32) |
| InChIKey | DAKKTWFLASFHHH-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.08 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |