C38H42Cl2N4O2 — CID 67700978
1-[(4-chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea (PubChem CID 67700978) has the molecular formula C38H42Cl2N4O2 and a molecular weight of 657.69 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea |
|---|---|
| PubChem CID | 67700978 |
| Molecular Formula | C38H42Cl2N4O2 |
| Molecular Weight | 657.69 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N(Cc1ccc(Cl)cc1)C1CCCC1.O=C(Nc1ccccc1)N(Cc1ccc(Cl)cc1)C1CCCC1 |
| InChI | InChI=1S/2C19H21ClN2O/c2*20-16-12-10-15(11-13-16)14-22(18-8-4-5-9-18)19(23)21-17-6-2-1-3-7-17/h2*1-3,6-7,10-13,18H,4-5,8-9,14H2,(H,21,23) |
| InChIKey | HDZUSAYORGUHMH-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.69 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |