C19H21ClN2O — CID 151779518
1-[(2-chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea (PubChem CID 151779518) has the molecular formula C19H21ClN2O and a molecular weight of 328.84 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea |
|---|---|
| PubChem CID | 151779518 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-1-cyclopentyl-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N(Cc1ccccc1Cl)C1CCCC1 |
| InChI | InChI=1S/C19H21ClN2O/c20-18-13-7-4-8-15(18)14-22(17-11-5-6-12-17)19(23)21-16-9-2-1-3-10-16/h1-4,7-10,13,17H,5-6,11-12,14H2,(H,21,23) |
| InChIKey | RUHIFZJSLUYFRS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |