C30H35ClN2O — CID 19935176
1-[(2-chlorophenyl)methyl]-3-(2,6-diethylphenyl)-1-(4-phenylcyclohexyl)urea (PubChem CID 19935176) has the molecular formula C30H35ClN2O and a molecular weight of 475.08 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-(2,6-diethylphenyl)-1-(4-phenylcyclohexyl)urea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-(2,6-diethylphenyl)-1-(4-phenylcyclohexyl)urea |
|---|---|
| PubChem CID | 19935176 |
| Molecular Formula | C30H35ClN2O |
| Molecular Weight | 475.08 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-(2,6-diethylphenyl)-1-(4-phenylcyclohexyl)urea |
| SMILES | CCc1cccc(CC)c1NC(=O)N(Cc1ccccc1Cl)C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C30H35ClN2O/c1-3-22-14-10-15-23(4-2)29(22)32-30(34)33(21-26-13-8-9-16-28(26)31)27-19-17-25(18-20-27)24-11-6-5-7-12-24/h5-16,25,27H,3-4,17-21H2,1-2H3,(H,32,34) |
| InChIKey | KJJLJIFYWIQDJK-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.08 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |