C26H26Cl2N2O — CID 19935194
1-benzyl-3-(2,5-dichlorophenyl)-1-(4-phenylcyclohexyl)urea (PubChem CID 19935194) has the molecular formula C26H26Cl2N2O and a molecular weight of 453.41 g/mol. Its IUPAC name is 1-benzyl-3-(2,5-dichlorophenyl)-1-(4-phenylcyclohexyl)urea.
| Compound Name | 1-benzyl-3-(2,5-dichlorophenyl)-1-(4-phenylcyclohexyl)urea |
|---|---|
| PubChem CID | 19935194 |
| Molecular Formula | C26H26Cl2N2O |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 1-benzyl-3-(2,5-dichlorophenyl)-1-(4-phenylcyclohexyl)urea |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)N(Cc1ccccc1)C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H26Cl2N2O/c27-22-13-16-24(28)25(17-22)29-26(31)30(18-19-7-3-1-4-8-19)23-14-11-21(12-15-23)20-9-5-2-6-10-20/h1-10,13,16-17,21,23H,11-12,14-15,18H2,(H,29,31) |
| InChIKey | ARNIBQJZLCXYCT-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |