C24H32ClN3O2 — CID 140907556
1-benzyl-1-(1-butylpiperidin-4-yl)-3-(2-chloro-5-methoxyphenyl)urea (PubChem CID 140907556) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(2-chloro-5-methoxyphenyl)urea.
| Compound Name | 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(2-chloro-5-methoxyphenyl)urea |
|---|---|
| PubChem CID | 140907556 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(2-chloro-5-methoxyphenyl)urea |
| SMILES | CCCCN1CCC(N(Cc2ccccc2)C(=O)Nc2cc(OC)ccc2Cl)CC1 |
| InChI | InChI=1S/C24H32ClN3O2/c1-3-4-14-27-15-12-20(13-16-27)28(18-19-8-6-5-7-9-19)24(29)26-23-17-21(30-2)10-11-22(23)25/h5-11,17,20H,3-4,12-16,18H2,1-2H3,(H,26,29) |
| InChIKey | CBSYHHOLTUOXNE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |