C26H37N3O3 — CID 24730828
1-(2-methoxyethyl)-3-(2-methoxy-5-methylphenyl)-1-[1-(3-phenylpropyl)piperidin-4-yl]urea (PubChem CID 24730828) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-(2-methoxy-5-methylphenyl)-1-[1-(3-phenylpropyl)piperidin-4-yl]urea.
| Compound Name | 1-(2-methoxyethyl)-3-(2-methoxy-5-methylphenyl)-1-[1-(3-phenylpropyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 24730828 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 1-(2-methoxyethyl)-3-(2-methoxy-5-methylphenyl)-1-[1-(3-phenylpropyl)piperidin-4-yl]urea |
| SMILES | COCCN(C(=O)Nc1cc(C)ccc1OC)C1CCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H37N3O3/c1-21-11-12-25(32-3)24(20-21)27-26(30)29(18-19-31-2)23-13-16-28(17-14-23)15-7-10-22-8-5-4-6-9-22/h4-6,8-9,11-12,20,23H,7,10,13-19H2,1-3H3,(H,27,30) |
| InChIKey | MESYZSXBOKFWOJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |