C27H33N3O2 — CID 53207380
1-cyclopentyl-1-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-3-(2-methoxy-5-methylphenyl)urea (PubChem CID 53207380) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 1-cyclopentyl-1-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-3-(2-methoxy-5-methylphenyl)urea.
| Compound Name | 1-cyclopentyl-1-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-3-(2-methoxy-5-methylphenyl)urea |
|---|---|
| PubChem CID | 53207380 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 1-cyclopentyl-1-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-3-(2-methoxy-5-methylphenyl)urea |
| SMILES | COc1ccc(C)cc1NC(=O)N(Cc1cc(C)n(-c2ccccc2)c1C)C1CCCC1 |
| InChI | InChI=1S/C27H33N3O2/c1-19-14-15-26(32-4)25(16-19)28-27(31)29(23-10-8-9-11-23)18-22-17-20(2)30(21(22)3)24-12-6-5-7-13-24/h5-7,12-17,23H,8-11,18H2,1-4H3,(H,28,31) |
| InChIKey | JGTCZVPHOCWAET-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|