C20H27N3O — CID 110642175
1-cyclohexyl-3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]urea (PubChem CID 110642175) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]urea.
| Compound Name | 1-cyclohexyl-3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 110642175 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 1-cyclohexyl-3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]urea |
| SMILES | Cc1cc(CNC(=O)NC2CCCCC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C20H27N3O/c1-15-13-17(16(2)23(15)19-11-7-4-8-12-19)14-21-20(24)22-18-9-5-3-6-10-18/h4,7-8,11-13,18H,3,5-6,9-10,14H2,1-2H3,(H2,21,22,24) |
| InChIKey | KOSXYVOWWCCMSU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|