C18H22N2O — CID 110642184
N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]cyclobutanecarboxamide (PubChem CID 110642184) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]cyclobutanecarboxamide.
| Compound Name | N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 110642184 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]cyclobutanecarboxamide |
| SMILES | Cc1cc(CNC(=O)C2CCC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C18H22N2O/c1-13-11-16(12-19-18(21)15-7-6-8-15)14(2)20(13)17-9-4-3-5-10-17/h3-5,9-11,15H,6-8,12H2,1-2H3,(H,19,21) |
| InChIKey | QIUAODJFPZANKW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|