C17H23N3O — CID 60865560
4-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylamino]butanamide (PubChem CID 60865560) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylamino]butanamide.
| Compound Name | 4-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 60865560 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 4-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylamino]butanamide |
| SMILES | Cc1cc(CNCCCC(N)=O)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C17H23N3O/c1-13-11-15(12-19-10-6-9-17(18)21)14(2)20(13)16-7-4-3-5-8-16/h3-5,7-8,11,19H,6,9-10,12H2,1-2H3,(H2,18,21) |
| InChIKey | QINUBLSIBGJYOA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|