C17H23N3O — CID 43214585
2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylamino]-N,N-dimethylacetamide (PubChem CID 43214585) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 43214585 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylamino]-N,N-dimethylacetamide |
| SMILES | Cc1cc(CNCC(=O)N(C)C)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C17H23N3O/c1-13-10-15(11-18-12-17(21)19(3)4)14(2)20(13)16-8-6-5-7-9-16/h5-10,18H,11-12H2,1-4H3 |
| InChIKey | GFFMDBGVEYQIHY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|