C16H21N3O — CID 43553150
3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylamino]propanamide (PubChem CID 43553150) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylamino]propanamide.
| Compound Name | 3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 43553150 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylamino]propanamide |
| SMILES | Cc1cc(CNCCC(N)=O)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C16H21N3O/c1-12-10-14(11-18-9-8-16(17)20)13(2)19(12)15-6-4-3-5-7-15/h3-7,10,18H,8-9,11H2,1-2H3,(H2,17,20) |
| InChIKey | VAIUUBQHADVDJP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|