C14H18N2 — CID 43090175
1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-methylmethanamine (PubChem CID 43090175) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-methylmethanamine.
| Compound Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 43090175 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-methylmethanamine |
| SMILES | CNCc1cc(C)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C14H18N2/c1-11-9-13(10-15-3)12(2)16(11)14-7-5-4-6-8-14/h4-9,15H,10H2,1-3H3 |
| InChIKey | GACAYHPMVNHLIB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|