C18H19N3O3 — CID 166396384
N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-5-methyl-3-oxo-1,2-oxazole-4-carboxamide (PubChem CID 166396384) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-5-methyl-3-oxo-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-5-methyl-3-oxo-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 166396384 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-5-methyl-3-oxo-1,2-oxazole-4-carboxamide |
| SMILES | Cc1o[nH]c(=O)c1C(=O)NCc1cc(C)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C18H19N3O3/c1-11-9-14(12(2)21(11)15-7-5-4-6-8-15)10-19-17(22)16-13(3)24-20-18(16)23/h4-9H,10H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | AMUPMKMODYCHGB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|