C21H19ClN4O — CID 100788331
2-chloro-N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-3H-benzimidazole-5-carboxamide (PubChem CID 100788331) has the molecular formula C21H19ClN4O and a molecular weight of 378.86 g/mol. Its IUPAC name is 2-chloro-N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-chloro-N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 100788331 |
| Molecular Formula | C21H19ClN4O |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-chloro-N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2ccc3nc(Cl)[nH]c3c2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C21H19ClN4O/c1-13-10-16(14(2)26(13)17-6-4-3-5-7-17)12-23-20(27)15-8-9-18-19(11-15)25-21(22)24-18/h3-11H,12H2,1-2H3,(H,23,27)(H,24,25) |
| InChIKey | GSLATWPPGWDYDB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|