C24H25ClN4O — CID 100787847
2-chloro-N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-N-propan-2-yl-3H-benzimidazole-5-carboxamide (PubChem CID 100787847) has the molecular formula C24H25ClN4O and a molecular weight of 420.94 g/mol. Its IUPAC name is 2-chloro-N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-N-propan-2-yl-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-chloro-N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-N-propan-2-yl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 100787847 |
| Molecular Formula | C24H25ClN4O |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-chloro-N-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]-N-propan-2-yl-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1cc(CN(C(=O)c2ccc3nc(Cl)[nH]c3c2)C(C)C)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C24H25ClN4O/c1-15(2)28(23(30)18-10-11-21-22(13-18)27-24(25)26-21)14-19-12-16(3)29(17(19)4)20-8-6-5-7-9-20/h5-13,15H,14H2,1-4H3,(H,26,27) |
| InChIKey | JKTUPBZYJAYJBI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|