C28H23N3O — CID 92911953
(Z)-2-(1H-benzimidazol-2-yl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-phenylprop-2-en-1-one (PubChem CID 92911953) has the molecular formula C28H23N3O and a molecular weight of 417.51 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-phenylprop-2-en-1-one.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 92911953 |
| Molecular Formula | C28H23N3O |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-phenylprop-2-en-1-one |
| SMILES | Cc1cc(/C=C(\C(=O)c2ccccc2)c2nc3ccccc3[nH]2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C28H23N3O/c1-19-17-22(20(2)31(19)23-13-7-4-8-14-23)18-24(27(32)21-11-5-3-6-12-21)28-29-25-15-9-10-16-26(25)30-28/h3-18H,1-2H3,(H,29,30)/b24-18+ |
| InChIKey | YPJGDXKXKPZGCS-HKOYGPOVSA-N |
| XLogP | 6.39 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|