C23H21ClN4O — CID 163326720
(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile;hydrochloride (PubChem CID 163326720) has the molecular formula C23H21ClN4O and a molecular weight of 404.90 g/mol. Its IUPAC name is (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile;hydrochloride.
| Compound Name | (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 163326720 |
| Molecular Formula | C23H21ClN4O |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile;hydrochloride |
| SMILES | COc1ccc2nc(/C(C#N)=C/c3cc(C)n(-c4ccccc4)c3C)[nH]c2c1.Cl |
| InChI | InChI=1S/C23H20N4O.ClH/c1-15-11-17(16(2)27(15)19-7-5-4-6-8-19)12-18(14-24)23-25-21-10-9-20(28-3)13-22(21)26-23;/h4-13H,1-3H3,(H,25,26);1H/b18-12+; |
| InChIKey | VIWOYKWVZMOFQK-XMMWENQYSA-N |
| XLogP | 5.47 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|