C30H25FN4O — CID 5114783
3-[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 5114783) has the molecular formula C30H25FN4O and a molecular weight of 476.56 g/mol. Its IUPAC name is 3-[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5114783 |
| Molecular Formula | C30H25FN4O |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 3-[1-[4-[(2-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2nc(C(C#N)=Cc3cc(C)n(-c4ccc(OCc5ccccc5F)cc4)c3C)[nH]c2c1 |
| InChI | InChI=1S/C30H25FN4O/c1-19-8-13-28-29(14-19)34-30(33-28)24(17-32)16-23-15-20(2)35(21(23)3)25-9-11-26(12-10-25)36-18-22-6-4-5-7-27(22)31/h4-16H,18H2,1-3H3,(H,33,34) |
| InChIKey | PGBQGDGSQIAAQG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|