C22H19FN2O — CID 3532033
2-(2-fluorophenyl)-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile (PubChem CID 3532033) has the molecular formula C22H19FN2O and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile.
| Compound Name | 2-(2-fluorophenyl)-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3532033 |
| Molecular Formula | C22H19FN2O |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-(2-fluorophenyl)-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile |
| SMILES | COc1ccc(-n2c(C)cc(C=C(C#N)c3ccccc3F)c2C)cc1 |
| InChI | InChI=1S/C22H19FN2O/c1-15-12-17(13-18(14-24)21-6-4-5-7-22(21)23)16(2)25(15)19-8-10-20(26-3)11-9-19/h4-13H,1-3H3 |
| InChIKey | IYOWWDMJUVPCFJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|