C24H23FN2 — CID 3525897
3-[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]-2-(2-fluorophenyl)prop-2-enenitrile (PubChem CID 3525897) has the molecular formula C24H23FN2 and a molecular weight of 358.46 g/mol. Its IUPAC name is 3-[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]-2-(2-fluorophenyl)prop-2-enenitrile.
| Compound Name | 3-[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]-2-(2-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3525897 |
| Molecular Formula | C24H23FN2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]-2-(2-fluorophenyl)prop-2-enenitrile |
| SMILES | Cc1cc(C)c(-n2c(C)cc(C=C(C#N)c3ccccc3F)c2C)c(C)c1 |
| InChI | InChI=1S/C24H23FN2/c1-15-10-16(2)24(17(3)11-15)27-18(4)12-20(19(27)5)13-21(14-26)22-8-6-7-9-23(22)25/h6-13H,1-5H3 |
| InChIKey | JIYVAGZJHSEQSS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|