C21H17ClN2O — CID 5030808
2-(2-chlorophenyl)-3-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile (PubChem CID 5030808) has the molecular formula C21H17ClN2O and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile.
| Compound Name | 2-(2-chlorophenyl)-3-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 5030808 |
| Molecular Formula | C21H17ClN2O |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-(2-chlorophenyl)-3-[1-(4-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1cc(C=C(C#N)c2ccccc2Cl)c(C)n1-c1ccc(O)cc1 |
| InChI | InChI=1S/C21H17ClN2O/c1-14-11-16(12-17(13-23)20-5-3-4-6-21(20)22)15(2)24(14)18-7-9-19(25)10-8-18/h3-12,25H,1-2H3 |
| InChIKey | LJMVANMOVOFNHL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|