C24H23ClN2 — CID 3933290
2-(2-chlorophenyl)-3-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]prop-2-enenitrile (PubChem CID 3933290) has the molecular formula C24H23ClN2 and a molecular weight of 374.92 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]prop-2-enenitrile.
| Compound Name | 2-(2-chlorophenyl)-3-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3933290 |
| Molecular Formula | C24H23ClN2 |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-(2-chlorophenyl)-3-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1cc(C=C(C#N)c2ccccc2Cl)c(C)n1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C24H23ClN2/c1-16(2)19-9-11-22(12-10-19)27-17(3)13-20(18(27)4)14-21(15-26)23-7-5-6-8-24(23)25/h5-14,16H,1-4H3 |
| InChIKey | KAEPCGXDXKSDBW-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|